2,4-Dimethoxy-3-methylthio-β-nitrostyrene
1,3-Dimethoxy-2-(methylsulfanyl)-4-[(E)-2-nitroethenyl]benzene
 12377  C11H13NO4S  255.29
 InChI=1S/C11H13NO4S/c1-15-9-5-4-8(6-7-12(13)14)10(16-2)11(9)17-3/h4-7H,1-3H3/b7-6+
 XZUTWEKHFLEHBH-VOTSOKGWSA-N This stereoisomer Any stereoisomer
 COc1c(ccc(c1SC)OC)/C=C/N(=O)=O