1-(4-Chlorophenyl)-N,N-dimethylpropan-2-amine
 10587  C11H16ClN  197.704
 InChI=1S/C11H16ClN/c1-9(13(2)3)8-10-4-6-11(12)7-5-10/h4-7,9H,8H2,1-3H3
 DUZIUJWBWTXQGI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(N(C)C)Cc1ccc(cc1)Cl