2C-YNP
2-[2,5-Dimethoxy-4-(prop-2-yn-1-yl)phenyl]ethan-1-amine
 10315 C13H17NO2 219.28
 InChI=1S/C13H17NO2/c1-4-5-10-8-13(16-3)11(6-7-14)9-12(10)15-2/h1,8-9H,5-7,14H2,2-3H3
 HLMXRIYWRZAAMX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)CC#C