ψ-DOYN
1-(4-Ethynyl-2,6-dimethoxyphenyl)propan-2-amine
 10245 C13H17NO2 219.28
 InChI=1S/C13H17NO2/c1-5-10-7-12(15-3)11(6-9(2)14)13(8-10)16-4/h1,7-9H,6,14H2,2-4H3
 XXOHJECFADCEQI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C#C)cc(c1CC(N)C)OC