5,8-Dimethoxy-1,2,3,4-tetrahydro-1,4-methanonaphthalen-9-amine
 10232 C13H17NO2 219.28
 InChI=1S/C13H17NO2/c1-15-9-5-6-10(16-2)12-8-4-3-7(11(9)12)13(8)14/h5-8,13H,3-4,14H2,1-2H3
 PVFNNXFCCWEIPX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(c2c1C1CCC2C1N)OC