MDCP
N-[1-(2H-1,3-Benzodioxol-5-yl)propan-2-yl]cyclopropanamine
 10170 C13H17NO2 219.28
 InChI=1S/C13H17NO2/c1-9(14-11-3-4-11)6-10-2-5-12-13(7-10)16-8-15-12/h2,5,7,9,11,14H,3-4,6,8H2,1H3
 XKUPANACGUXRCS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc2c(c1)OCO2)NC1CC1