3-(2-Amino-1-hydroxyethyl)-4-sulfanylphenol
 10103  C8H11NO2S  185.243
 InChI=1S/C8H11NO2S/c9-4-7(11)6-3-5(10)1-2-8(6)12/h1-3,7,10-12H,4,9H2
 MROPGFOZFYKJQH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(c1cc(O)ccc1S)O