2-[3-Ethoxy-2-(3-methylbutyl)phenyl]ethan-1-amine
 10036  C15H25NO  235.365
 InChI=1S/C15H25NO/c1-4-17-15-7-5-6-13(10-11-16)14(15)9-8-12(2)3/h5-7,12H,4,8-11,16H2,1-3H3
 IYSWDVLFHOOXFG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cccc(c1CCC(C)C)OCC