2-(2-Butoxy-3-methoxyphenyl)ethan-1-amine
 10028 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-3-4-10-16-13-11(8-9-14)6-5-7-12(13)15-2/h5-7H,3-4,8-10,14H2,1-2H3
 YBDUSQONCLVACJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCOc1c(CCN)cccc1OC